C23H21N3O5S — CID 16817027
3-[[3-(3,4-dimethoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]pentane-2,4-dione (PubChem CID 16817027) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is 3-[[3-(3,4-dimethoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]pentane-2,4-dione.
| Compound Name | 3-[[3-(3,4-dimethoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 16817027 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 3-[[3-(3,4-dimethoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]pentane-2,4-dione |
| SMILES | COc1ccc(-n2c(SC(C(C)=O)C(C)=O)nc3c([nH]c4ccccc43)c2=O)cc1OC |
| InChI | InChI=1S/C23H21N3O5S/c1-12(27)21(13(2)28)32-23-25-19-15-7-5-6-8-16(15)24-20(19)22(29)26(23)14-9-10-17(30-3)18(11-14)31-4/h5-11,21,24H,1-4H3 |
| InChIKey | OVRWAHRWADIMNX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|