C22H19N3O4S — CID 16816693
3-[[3-(2-methoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]pentane-2,4-dione (PubChem CID 16816693) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-[[3-(2-methoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]pentane-2,4-dione.
| Compound Name | 3-[[3-(2-methoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 16816693 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 3-[[3-(2-methoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]pentane-2,4-dione |
| SMILES | COc1ccccc1-n1c(SC(C(C)=O)C(C)=O)nc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C22H19N3O4S/c1-12(26)20(13(2)27)30-22-24-18-14-8-4-5-9-15(14)23-19(18)21(28)25(22)16-10-6-7-11-17(16)29-3/h4-11,20,23H,1-3H3 |
| InChIKey | HJLWCPIWNZLXHD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|