C25H19N5O5S — CID 16816644
2-[[3-(2-methoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 16816644) has the molecular formula C25H19N5O5S and a molecular weight of 501.52 g/mol. Its IUPAC name is 2-[[3-(2-methoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[3-(2-methoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16816644 |
| Molecular Formula | C25H19N5O5S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2-[[3-(2-methoxyphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccccc1-n1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)nc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C25H19N5O5S/c1-35-20-9-5-4-8-19(20)29-24(32)23-22(17-6-2-3-7-18(17)27-23)28-25(29)36-14-21(31)26-15-10-12-16(13-11-15)30(33)34/h2-13,27H,14H2,1H3,(H,26,31) |
| InChIKey | QEOKTRCASOAOJT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|