C24H16N6O6S — CID 4184006
N-(4-nitrophenyl)-2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetamide (PubChem CID 4184006) has the molecular formula C24H16N6O6S and a molecular weight of 516.50 g/mol. Its IUPAC name is N-(4-nitrophenyl)-2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-nitrophenyl)-2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4184006 |
| Molecular Formula | C24H16N6O6S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | N-(4-nitrophenyl)-2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2c([nH]c3ccccc32)c(=O)n1-c1ccc([N+](=O)[O-])cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H16N6O6S/c31-20(25-14-5-7-16(8-6-14)29(33)34)13-37-24-27-21-18-3-1-2-4-19(18)26-22(21)23(32)28(24)15-9-11-17(12-10-15)30(35)36/h1-12,26H,13H2,(H,25,31) |
| InChIKey | ZSFIGAGTYUVLJD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 166.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|