C25H18ClN5O5S — CID 4126073
N-(5-chloro-2-methoxyphenyl)-2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetamide (PubChem CID 4126073) has the molecular formula C25H18ClN5O5S and a molecular weight of 535.97 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4126073 |
| Molecular Formula | C25H18ClN5O5S |
| Molecular Weight | 535.97 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nc2c([nH]c3ccccc32)c(=O)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H18ClN5O5S/c1-36-20-11-6-14(26)12-19(20)27-21(32)13-37-25-29-22-17-4-2-3-5-18(17)28-23(22)24(33)30(25)15-7-9-16(10-8-15)31(34)35/h2-12,28H,13H2,1H3,(H,27,32) |
| InChIKey | KQXBDBKMDRNVDL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.97 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|