C27H23N5O4S — CID 4257144
2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 4257144) has the molecular formula C27H23N5O4S and a molecular weight of 513.58 g/mol. Its IUPAC name is 2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 4257144 |
| Molecular Formula | C27H23N5O4S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 2-[[3-(4-nitrophenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CSc2nc3c([nH]c4ccccc43)c(=O)n2-c2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C27H23N5O4S/c1-15-12-16(2)23(17(3)13-15)29-22(33)14-37-27-30-24-20-6-4-5-7-21(20)28-25(24)26(34)31(27)18-8-10-19(11-9-18)32(35)36/h4-13,28H,14H2,1-3H3,(H,29,33) |
| InChIKey | JNBCUYKQEZMBLX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|