C25H20N4O3S — CID 4130555
2-[(2,5-dimethylphenyl)methylsulfanyl]-3-(4-nitrophenyl)-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 4130555) has the molecular formula C25H20N4O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methylsulfanyl]-3-(4-nitrophenyl)-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 2-[(2,5-dimethylphenyl)methylsulfanyl]-3-(4-nitrophenyl)-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 4130555 |
| Molecular Formula | C25H20N4O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methylsulfanyl]-3-(4-nitrophenyl)-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | Cc1ccc(C)c(CSc2nc3c([nH]c4ccccc43)c(=O)n2-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H20N4O3S/c1-15-7-8-16(2)17(13-15)14-33-25-27-22-20-5-3-4-6-21(20)26-23(22)24(30)28(25)18-9-11-19(12-10-18)29(31)32/h3-13,26H,14H2,1-2H3 |
| InChIKey | FBPNPZPBNCVWMY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|