C23H15N5O5S — CID 23875234
3-(4-nitrophenyl)-2-[(4-nitrophenyl)methylsulfanyl]-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 23875234) has the molecular formula C23H15N5O5S and a molecular weight of 473.47 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-2-[(4-nitrophenyl)methylsulfanyl]-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-(4-nitrophenyl)-2-[(4-nitrophenyl)methylsulfanyl]-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 23875234 |
| Molecular Formula | C23H15N5O5S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 3-(4-nitrophenyl)-2-[(4-nitrophenyl)methylsulfanyl]-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | O=c1c2[nH]c3ccccc3c2nc(SCc2ccc([N+](=O)[O-])cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H15N5O5S/c29-22-21-20(18-3-1-2-4-19(18)24-21)25-23(26(22)15-9-11-17(12-10-15)28(32)33)34-13-14-5-7-16(8-6-14)27(30)31/h1-12,24H,13H2 |
| InChIKey | UTBFVQIUCXLWPS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|