C25H20N4O4S — CID 2156197
3-(4-ethoxyphenyl)-2-[(4-nitrophenyl)methylsulfanyl]-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 2156197) has the molecular formula C25H20N4O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-2-[(4-nitrophenyl)methylsulfanyl]-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-(4-ethoxyphenyl)-2-[(4-nitrophenyl)methylsulfanyl]-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 2156197 |
| Molecular Formula | C25H20N4O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 3-(4-ethoxyphenyl)-2-[(4-nitrophenyl)methylsulfanyl]-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | CCOc1ccc(-n2c(SCc3ccc([N+](=O)[O-])cc3)nc3c([nH]c4ccccc43)c2=O)cc1 |
| InChI | InChI=1S/C25H20N4O4S/c1-2-33-19-13-11-17(12-14-19)28-24(30)23-22(20-5-3-4-6-21(20)26-23)27-25(28)34-15-16-7-9-18(10-8-16)29(31)32/h3-14,26H,2,15H2,1H3 |
| InChIKey | BNNAZZSDDJWWGZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|