C26H21N5O5S — CID 16817085
2-[[3-(2-methoxy-5-methylphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 16817085) has the molecular formula C26H21N5O5S and a molecular weight of 515.55 g/mol. Its IUPAC name is 2-[[3-(2-methoxy-5-methylphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[3-(2-methoxy-5-methylphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16817085 |
| Molecular Formula | C26H21N5O5S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-[[3-(2-methoxy-5-methylphenyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(C)cc1-n1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)nc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C26H21N5O5S/c1-15-7-12-21(36-2)20(13-15)30-25(33)24-23(18-5-3-4-6-19(18)28-24)29-26(30)37-14-22(32)27-16-8-10-17(11-9-16)31(34)35/h3-13,28H,14H2,1-2H3,(H,27,32) |
| InChIKey | ICBNBXHNUVWGIA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|