C24H17FN4O6S — CID 16818874
ethyl 3-(3-fluorophenyl)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-oxothieno[3,4-d]pyridazine-1-carboxylate (PubChem CID 16818874) has the molecular formula C24H17FN4O6S and a molecular weight of 508.49 g/mol. Its IUPAC name is ethyl 3-(3-fluorophenyl)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-oxothieno[3,4-d]pyridazine-1-carboxylate.
| Compound Name | ethyl 3-(3-fluorophenyl)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
|---|---|
| PubChem CID | 16818874 |
| Molecular Formula | C24H17FN4O6S |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | ethyl 3-(3-fluorophenyl)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2cccc(F)c2)c(=O)c2c(NC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)scc12 |
| InChI | InChI=1S/C24H17FN4O6S/c1-2-35-24(32)21-18-13-36-22(20(18)23(31)28(27-21)17-5-3-4-15(25)12-17)26-19(30)11-8-14-6-9-16(10-7-14)29(33)34/h3-13H,2H2,1H3,(H,26,30)/b11-8+ |
| InChIKey | YTHFTWKXLNUKPJ-DHZHZOJOSA-N |
| XLogP | 4.32 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|