C26H23N3O4S — CID 16819432
ethyl 3-(3,4-dimethylphenyl)-4-oxo-5-[[(E)-3-phenylprop-2-enoyl]amino]thieno[3,4-d]pyridazine-1-carboxylate (PubChem CID 16819432) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is ethyl 3-(3,4-dimethylphenyl)-4-oxo-5-[[(E)-3-phenylprop-2-enoyl]amino]thieno[3,4-d]pyridazine-1-carboxylate.
| Compound Name | ethyl 3-(3,4-dimethylphenyl)-4-oxo-5-[[(E)-3-phenylprop-2-enoyl]amino]thieno[3,4-d]pyridazine-1-carboxylate |
|---|---|
| PubChem CID | 16819432 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | ethyl 3-(3,4-dimethylphenyl)-4-oxo-5-[[(E)-3-phenylprop-2-enoyl]amino]thieno[3,4-d]pyridazine-1-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)c(C)c2)c(=O)c2c(NC(=O)/C=C/c3ccccc3)scc12 |
| InChI | InChI=1S/C26H23N3O4S/c1-4-33-26(32)23-20-15-34-24(27-21(30)13-11-18-8-6-5-7-9-18)22(20)25(31)29(28-23)19-12-10-16(2)17(3)14-19/h5-15H,4H2,1-3H3,(H,27,30)/b13-11+ |
| InChIKey | NOECWTANXZHTRB-ACCUITESSA-N |
| XLogP | 4.89 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|