C21H22ClN3O4S — CID 16819383
ethyl 5-(4-chlorobutanoylamino)-3-(3,4-dimethylphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate (PubChem CID 16819383) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is ethyl 5-(4-chlorobutanoylamino)-3-(3,4-dimethylphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate.
| Compound Name | ethyl 5-(4-chlorobutanoylamino)-3-(3,4-dimethylphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
|---|---|
| PubChem CID | 16819383 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | ethyl 5-(4-chlorobutanoylamino)-3-(3,4-dimethylphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)c(C)c2)c(=O)c2c(NC(=O)CCCCl)scc12 |
| InChI | InChI=1S/C21H22ClN3O4S/c1-4-29-21(28)18-15-11-30-19(23-16(26)6-5-9-22)17(15)20(27)25(24-18)14-8-7-12(2)13(3)10-14/h7-8,10-11H,4-6,9H2,1-3H3,(H,23,26) |
| InChIKey | XWLJPLJHIGGEEV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|