C18H15ClFN3O4S — CID 4581083
ethyl 5-(3-chloropropanoylamino)-3-(4-fluorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate (PubChem CID 4581083) has the molecular formula C18H15ClFN3O4S and a molecular weight of 423.85 g/mol. Its IUPAC name is ethyl 5-(3-chloropropanoylamino)-3-(4-fluorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate.
| Compound Name | ethyl 5-(3-chloropropanoylamino)-3-(4-fluorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
|---|---|
| PubChem CID | 4581083 |
| Molecular Formula | C18H15ClFN3O4S |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | ethyl 5-(3-chloropropanoylamino)-3-(4-fluorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(F)cc2)c(=O)c2c(NC(=O)CCCl)scc12 |
| InChI | InChI=1S/C18H15ClFN3O4S/c1-2-27-18(26)15-12-9-28-16(21-13(24)7-8-19)14(12)17(25)23(22-15)11-5-3-10(20)4-6-11/h3-6,9H,2,7-8H2,1H3,(H,21,24) |
| InChIKey | MHEBNGMIZBYZRS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|