C22H14Cl2N4O6S — CID 16818944
ethyl 5-[(4-chloro-3-nitrobenzoyl)amino]-3-(3-chlorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate (PubChem CID 16818944) has the molecular formula C22H14Cl2N4O6S and a molecular weight of 533.35 g/mol. Its IUPAC name is ethyl 5-[(4-chloro-3-nitrobenzoyl)amino]-3-(3-chlorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate.
| Compound Name | ethyl 5-[(4-chloro-3-nitrobenzoyl)amino]-3-(3-chlorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
|---|---|
| PubChem CID | 16818944 |
| Molecular Formula | C22H14Cl2N4O6S |
| Molecular Weight | 533.35 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | ethyl 5-[(4-chloro-3-nitrobenzoyl)amino]-3-(3-chlorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2cccc(Cl)c2)c(=O)c2c(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)scc12 |
| InChI | InChI=1S/C22H14Cl2N4O6S/c1-2-34-22(31)18-14-10-35-20(25-19(29)11-6-7-15(24)16(8-11)28(32)33)17(14)21(30)27(26-18)13-5-3-4-12(23)9-13/h3-10H,2H2,1H3,(H,25,29) |
| InChIKey | VFIYXYQGBLVKKJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|