C24H19ClN4O6S — CID 16819424
ethyl 5-[(5-chloro-2-nitrobenzoyl)amino]-3-(3,4-dimethylphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate (PubChem CID 16819424) has the molecular formula C24H19ClN4O6S and a molecular weight of 526.96 g/mol. Its IUPAC name is ethyl 5-[(5-chloro-2-nitrobenzoyl)amino]-3-(3,4-dimethylphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate.
| Compound Name | ethyl 5-[(5-chloro-2-nitrobenzoyl)amino]-3-(3,4-dimethylphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
|---|---|
| PubChem CID | 16819424 |
| Molecular Formula | C24H19ClN4O6S |
| Molecular Weight | 526.96 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | ethyl 5-[(5-chloro-2-nitrobenzoyl)amino]-3-(3,4-dimethylphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)c(C)c2)c(=O)c2c(NC(=O)c3cc(Cl)ccc3[N+](=O)[O-])scc12 |
| InChI | InChI=1S/C24H19ClN4O6S/c1-4-35-24(32)20-17-11-36-22(26-21(30)16-10-14(25)6-8-18(16)29(33)34)19(17)23(31)28(27-20)15-7-5-12(2)13(3)9-15/h5-11H,4H2,1-3H3,(H,26,30) |
| InChIKey | SLRLBIJPXPJZDQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.96 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|