C24H19BrN4O8S — CID 121030780
ethyl 3-(4-bromophenyl)-5-[(4,5-dimethoxy-2-nitrobenzoyl)amino]-4-oxothieno[3,4-d]pyridazine-1-carboxylate (PubChem CID 121030780) has the molecular formula C24H19BrN4O8S and a molecular weight of 603.41 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-5-[(4,5-dimethoxy-2-nitrobenzoyl)amino]-4-oxothieno[3,4-d]pyridazine-1-carboxylate.
| Compound Name | ethyl 3-(4-bromophenyl)-5-[(4,5-dimethoxy-2-nitrobenzoyl)amino]-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
|---|---|
| PubChem CID | 121030780 |
| Molecular Formula | C24H19BrN4O8S |
| Molecular Weight | 603.41 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-5-[(4,5-dimethoxy-2-nitrobenzoyl)amino]-4-oxothieno[3,4-d]pyridazine-1-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(Br)cc2)c(=O)c2c(NC(=O)c3cc(OC)c(OC)cc3[N+](=O)[O-])scc12 |
| InChI | InChI=1S/C24H19BrN4O8S/c1-4-37-24(32)20-15-11-38-22(19(15)23(31)28(27-20)13-7-5-12(25)6-8-13)26-21(30)14-9-17(35-2)18(36-3)10-16(14)29(33)34/h5-11H,4H2,1-3H3,(H,26,30) |
| InChIKey | YDPFFWYSDNJPGS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|