C24H25N5O4 — CID 16822591
9-(4-tert-butylphenyl)-2-(2,5-dimethoxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 16822591) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 9-(4-tert-butylphenyl)-2-(2,5-dimethoxyphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(4-tert-butylphenyl)-2-(2,5-dimethoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 16822591 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 9-(4-tert-butylphenyl)-2-(2,5-dimethoxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | COc1ccc(OC)c(-c2nc(C(N)=O)c3[nH]c(=O)n(-c4ccc(C(C)(C)C)cc4)c3n2)c1 |
| InChI | InChI=1S/C24H25N5O4/c1-24(2,3)13-6-8-14(9-7-13)29-22-19(27-23(29)31)18(20(25)30)26-21(28-22)16-12-15(32-4)10-11-17(16)33-5/h6-12H,1-5H3,(H2,25,30)(H,27,31) |
| InChIKey | CKJQERXZNYBUAX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |