C8H10O4 — CID 16823
cyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 16823) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is cyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | cyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 16823 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | cyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12) |
| InChIKey | ILUAAIDVFMVTAU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|