C20H22N4O6S2 — CID 16823137
4-[[2-oxo-2-(4-thiophen-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl)acetyl]amino]benzamide (PubChem CID 16823137) has the molecular formula C20H22N4O6S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is 4-[[2-oxo-2-(4-thiophen-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-oxo-2-(4-thiophen-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 16823137 |
| Molecular Formula | C20H22N4O6S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 4-[[2-oxo-2-(4-thiophen-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(=O)N2CCC3(CC2)OCCN3S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H22N4O6S2/c21-17(25)14-3-5-15(6-4-14)22-18(26)19(27)23-9-7-20(8-10-23)24(11-12-30-20)32(28,29)16-2-1-13-31-16/h1-6,13H,7-12H2,(H2,21,25)(H,22,26) |
| InChIKey | UMLGJOBJPIYKBV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|