C18H18ClN3O6S2 — CID 18577928
(2-chloro-4-nitrophenyl)-(4-thiophen-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl)methanone (PubChem CID 18577928) has the molecular formula C18H18ClN3O6S2 and a molecular weight of 471.94 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-(4-thiophen-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl)methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-(4-thiophen-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl)methanone |
|---|---|
| PubChem CID | 18577928 |
| Molecular Formula | C18H18ClN3O6S2 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-(4-thiophen-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1Cl)N1CCC2(CC1)OCCN2S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H18ClN3O6S2/c19-15-12-13(22(24)25)3-4-14(15)17(23)20-7-5-18(6-8-20)21(9-10-28-18)30(26,27)16-2-1-11-29-16/h1-4,11-12H,5-10H2 |
| InChIKey | BHDFWPFRYDUXJL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|