C20H24N6O3 — CID 16824803
6-[2-(4-ethoxyanilino)ethyl]-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 16824803) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 6-[2-(4-ethoxyanilino)ethyl]-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-[2-(4-ethoxyanilino)ethyl]-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 16824803 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 6-[2-(4-ethoxyanilino)ethyl]-4,7,8-trimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCOc1ccc(NCCn2c(C)c(C)n3c4c(=O)[nH]c(=O)n(C)c4nc23)cc1 |
| InChI | InChI=1S/C20H24N6O3/c1-5-29-15-8-6-14(7-9-15)21-10-11-25-12(2)13(3)26-16-17(22-19(25)26)24(4)20(28)23-18(16)27/h6-9,21H,5,10-11H2,1-4H3,(H,23,27,28) |
| InChIKey | DFHGLSLSNFZFOK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|