C23H29N3O7S — CID 16825640
N-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-[(4-methylphenyl)methyl]oxamide (PubChem CID 16825640) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is N-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-[(4-methylphenyl)methyl]oxamide.
| Compound Name | N-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-[(4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 16825640 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-[(4-methylphenyl)methyl]oxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCOC2CNC(=O)C(=O)NCc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C23H29N3O7S/c1-16-5-7-17(8-6-16)14-24-22(27)23(28)25-15-21-26(11-4-12-33-21)34(29,30)18-9-10-19(31-2)20(13-18)32-3/h5-10,13,21H,4,11-12,14-15H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | CBQTXUPXSSSSJB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|