C20H31N3O7S — CID 16825643
N'-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(3-methylbutyl)oxamide (PubChem CID 16825643) has the molecular formula C20H31N3O7S and a molecular weight of 457.55 g/mol. Its IUPAC name is N'-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(3-methylbutyl)oxamide.
| Compound Name | N'-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(3-methylbutyl)oxamide |
|---|---|
| PubChem CID | 16825643 |
| Molecular Formula | C20H31N3O7S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N'-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(3-methylbutyl)oxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCOC2CNC(=O)C(=O)NCCC(C)C)cc1OC |
| InChI | InChI=1S/C20H31N3O7S/c1-14(2)8-9-21-19(24)20(25)22-13-18-23(10-5-11-30-18)31(26,27)15-6-7-16(28-3)17(12-15)29-4/h6-7,12,14,18H,5,8-11,13H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | CNDREYOJMDLAAA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|