C17H25N3O8S — CID 18561446
N'-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]-N-(2-methoxyethyl)oxamide (PubChem CID 18561446) has the molecular formula C17H25N3O8S and a molecular weight of 431.47 g/mol. Its IUPAC name is N'-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]-N-(2-methoxyethyl)oxamide.
| Compound Name | N'-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]-N-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 18561446 |
| Molecular Formula | C17H25N3O8S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N'-[[3-(3,4-dimethoxyphenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]-N-(2-methoxyethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)NCC1OCCN1S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H25N3O8S/c1-25-8-6-18-16(21)17(22)19-11-15-20(7-9-28-15)29(23,24)12-4-5-13(26-2)14(10-12)27-3/h4-5,10,15H,6-9,11H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | ULPKGTBAKBECDO-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|