C18H44N6O12 — CID 168268387
2-Ammonioethanol ethylenediaminetetraacetate (PubChem CID 168268387) has the molecular formula C18H44N6O12 and a molecular weight of 536.60 g/mol. Its IUPAC name is 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(2-hydroxyethylazanium).
| Compound Name | 2-Ammonioethanol ethylenediaminetetraacetate |
|---|---|
| PubChem CID | 168268387 |
| Molecular Formula | C18H44N6O12 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(2-hydroxyethylazanium) |
| SMILES | C(CO)[NH3+].C(CO)[NH3+].C(CO)[NH3+].C(CO)[NH3+].C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C10H16N2O8.4C2H7NO/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;4*3-1-2-4/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);4*4H,1-3H2 |
| InChIKey | FWJJTGXGFKILGS-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 358.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | 303 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |