C21H22N2O3S3 — CID 16828258
N-(1-benzothiophen-5-yl)-1-(2-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16828258) has the molecular formula C21H22N2O3S3 and a molecular weight of 446.62 g/mol. Its IUPAC name is N-(1-benzothiophen-5-yl)-1-(2-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(1-benzothiophen-5-yl)-1-(2-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16828258 |
| Molecular Formula | C21H22N2O3S3 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-(1-benzothiophen-5-yl)-1-(2-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CSc1ccccc1S(=O)(=O)N1CCC(C(=O)Nc2ccc3sccc3c2)CC1 |
| InChI | InChI=1S/C21H22N2O3S3/c1-27-19-4-2-3-5-20(19)29(25,26)23-11-8-15(9-12-23)21(24)22-17-6-7-18-16(14-17)10-13-28-18/h2-7,10,13-15H,8-9,11-12H2,1H3,(H,22,24) |
| InChIKey | AJYHUJGPKXRMQA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |