C23H26N4O5S — CID 16829718
N'-(2-cyanophenyl)-N-[2-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide (PubChem CID 16829718) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is N'-(2-cyanophenyl)-N-[2-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide.
| Compound Name | N'-(2-cyanophenyl)-N-[2-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 16829718 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N'-(2-cyanophenyl)-N-[2-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2CCNC(=O)C(=O)Nc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C23H26N4O5S/c1-32-19-9-11-20(12-10-19)33(30,31)27-15-5-4-7-18(27)13-14-25-22(28)23(29)26-21-8-3-2-6-17(21)16-24/h2-3,6,8-12,18H,4-5,7,13-15H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | HLWGZGLDCVSKQN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|