C16H23N3O4S — CID 7280249
N'-[2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]ethyl]-N-methyloxamide (PubChem CID 7280249) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is N'-[2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]ethyl]-N-methyloxamide.
| Compound Name | N'-[2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]ethyl]-N-methyloxamide |
|---|---|
| PubChem CID | 7280249 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N'-[2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]ethyl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NCC[C@@H]1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O4S/c1-17-15(20)16(21)18-11-10-13-7-5-6-12-19(13)24(22,23)14-8-3-2-4-9-14/h2-4,8-9,13H,5-7,10-12H2,1H3,(H,17,20)(H,18,21)/t13-/m0/s1 |
| InChIKey | SVDBJJSXVHVPOL-ZDUSSCGKSA-N |
| XLogP | 0.48 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|