C21H23F2N3O4S — CID 41194125
N-[2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]ethyl]-N'-(2,4-difluorophenyl)oxamide (PubChem CID 41194125) has the molecular formula C21H23F2N3O4S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]ethyl]-N'-(2,4-difluorophenyl)oxamide.
| Compound Name | N-[2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]ethyl]-N'-(2,4-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 41194125 |
| Molecular Formula | C21H23F2N3O4S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]ethyl]-N'-(2,4-difluorophenyl)oxamide |
| SMILES | O=C(NCC[C@@H]1CCCCN1S(=O)(=O)c1ccccc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C21H23F2N3O4S/c22-15-9-10-19(18(23)14-15)25-21(28)20(27)24-12-11-16-6-4-5-13-26(16)31(29,30)17-7-2-1-3-8-17/h1-3,7-10,14,16H,4-6,11-13H2,(H,24,27)(H,25,28)/t16-/m0/s1 |
| InChIKey | HPICNXSPVXMOKA-INIZCTEOSA-N |
| XLogP | 2.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|