C26H25N3O4 — CID 16830173
3,4-diethoxy-N-[3-(2-methyl-4-oxoquinazolin-3-yl)phenyl]benzamide (PubChem CID 16830173) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3,4-diethoxy-N-[3-(2-methyl-4-oxoquinazolin-3-yl)phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[3-(2-methyl-4-oxoquinazolin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 16830173 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3,4-diethoxy-N-[3-(2-methyl-4-oxoquinazolin-3-yl)phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cccc(-n3c(C)nc4ccccc4c3=O)c2)cc1OCC |
| InChI | InChI=1S/C26H25N3O4/c1-4-32-23-14-13-18(15-24(23)33-5-2)25(30)28-19-9-8-10-20(16-19)29-17(3)27-22-12-7-6-11-21(22)26(29)31/h6-16H,4-5H2,1-3H3,(H,28,30) |
| InChIKey | LOXCMSBOZZAKHQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |