C24H29N3O3S2 — CID 16831380
4-[cyclohexyl(ethyl)sulfamoyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 16831380) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-[cyclohexyl(ethyl)sulfamoyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[cyclohexyl(ethyl)sulfamoyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 16831380 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 4-[cyclohexyl(ethyl)sulfamoyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCc1cccc2sc(NC(=O)c3ccc(S(=O)(=O)N(CC)C4CCCCC4)cc3)nc12 |
| InChI | InChI=1S/C24H29N3O3S2/c1-3-17-9-8-12-21-22(17)25-24(31-21)26-23(28)18-13-15-20(16-14-18)32(29,30)27(4-2)19-10-6-5-7-11-19/h8-9,12-16,19H,3-7,10-11H2,1-2H3,(H,25,26,28) |
| InChIKey | JQINPPQZHKTSON-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |