C23H27N3O3S2 — CID 16825437
N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(2-ethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 16825437) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(2-ethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(2-ethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 16825437 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(2-ethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CCc1cccc2sc(NC(=O)c3ccc(S(=O)(=O)N4CCCCC4CC)cc3)nc12 |
| InChI | InChI=1S/C23H27N3O3S2/c1-3-16-8-7-10-20-21(16)24-23(30-20)25-22(27)17-11-13-19(14-12-17)31(28,29)26-15-6-5-9-18(26)4-2/h7-8,10-14,18H,3-6,9,15H2,1-2H3,(H,24,25,27) |
| InChIKey | ZNSQIVFDGWLMQU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |