C21H23ClN4O3S2 — CID 41043733
N'-(4-chloro-1,3-benzothiazol-2-yl)-4-[(2S)-2-ethylpiperidin-1-yl]sulfonylbenzohydrazide (PubChem CID 41043733) has the molecular formula C21H23ClN4O3S2 and a molecular weight of 479.03 g/mol. Its IUPAC name is N'-(4-chloro-1,3-benzothiazol-2-yl)-4-[(2S)-2-ethylpiperidin-1-yl]sulfonylbenzohydrazide.
| Compound Name | N'-(4-chloro-1,3-benzothiazol-2-yl)-4-[(2S)-2-ethylpiperidin-1-yl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 41043733 |
| Molecular Formula | C21H23ClN4O3S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N'-(4-chloro-1,3-benzothiazol-2-yl)-4-[(2S)-2-ethylpiperidin-1-yl]sulfonylbenzohydrazide |
| SMILES | CC[C@H]1CCCCN1S(=O)(=O)c1ccc(C(=O)NNc2nc3c(Cl)cccc3s2)cc1 |
| InChI | InChI=1S/C21H23ClN4O3S2/c1-2-15-6-3-4-13-26(15)31(28,29)16-11-9-14(10-12-16)20(27)24-25-21-23-19-17(22)7-5-8-18(19)30-21/h5,7-12,15H,2-4,6,13H2,1H3,(H,23,25)(H,24,27)/t15-/m0/s1 |
| InChIKey | GISPUIDGXOPWMZ-HNNXBMFYSA-N |
| XLogP | 4.66 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|