C23H28N4O5S2 — CID 41043781
N'-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4-[(2R)-2-ethylpiperidin-1-yl]sulfonylbenzohydrazide (PubChem CID 41043781) has the molecular formula C23H28N4O5S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is N'-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4-[(2R)-2-ethylpiperidin-1-yl]sulfonylbenzohydrazide.
| Compound Name | N'-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4-[(2R)-2-ethylpiperidin-1-yl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 41043781 |
| Molecular Formula | C23H28N4O5S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | N'-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4-[(2R)-2-ethylpiperidin-1-yl]sulfonylbenzohydrazide |
| SMILES | CC[C@@H]1CCCCN1S(=O)(=O)c1ccc(C(=O)NNc2nc3c(OC)ccc(OC)c3s2)cc1 |
| InChI | InChI=1S/C23H28N4O5S2/c1-4-16-7-5-6-14-27(16)34(29,30)17-10-8-15(9-11-17)22(28)25-26-23-24-20-18(31-2)12-13-19(32-3)21(20)33-23/h8-13,16H,4-7,14H2,1-3H3,(H,24,26)(H,25,28)/t16-/m1/s1 |
| InChIKey | BHDJQGYOFHYKDS-MRXNPFEDSA-N |
| XLogP | 4.02 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|