C26H22N2O3S2 — CID 16834893
4-phenyl-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzamide (PubChem CID 16834893) has the molecular formula C26H22N2O3S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-phenyl-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzamide.
| Compound Name | 4-phenyl-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 16834893 |
| Molecular Formula | C26H22N2O3S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 4-phenyl-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCCN2S(=O)(=O)c1cccs1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N2O3S2/c29-26(21-12-10-20(11-13-21)19-6-2-1-3-7-19)27-23-14-15-24-22(18-23)8-4-16-28(24)33(30,31)25-9-5-17-32-25/h1-3,5-7,9-15,17-18H,4,8,16H2,(H,27,29) |
| InChIKey | NKUOLIYMPWOPCS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |