About 2-butylsulfanyl-1,3-benzothiazole
2-butylsulfanyl-1,3-benzothiazole (PubChem CID 16838) has the molecular formula C11H13NS2
and a molecular weight of 223.37 g/mol. Its IUPAC name is 2-butylsulfanyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-butylsulfanyl-1,3-benzothiazole |
| PubChem CID | 16838 |
| Molecular Formula | C11H13NS2 |
| Molecular Weight | 223.37 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-butylsulfanyl-1,3-benzothiazole |
| SMILES | CCCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H13NS2/c1-2-3-8-13-11-12-9-6-4-5-7-10(9)14-11/h4-7H,2-3,8H2,1H3 |
| InChIKey | PXSCUDKGNNWGBZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butylsulfanyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfanyl-1,3-benzothiazole?
The IUPAC name of 2-butylsulfanyl-1,3-benzothiazole (CID 16838) is 2-butylsulfanyl-1,3-benzothiazole.
What is the SMILES notation for 2-butylsulfanyl-1,3-benzothiazole?
The canonical SMILES for 2-butylsulfanyl-1,3-benzothiazole is CCCCSc1nc2ccccc2s1.
What is the InChIKey of 2-butylsulfanyl-1,3-benzothiazole?
The InChIKey is PXSCUDKGNNWGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS2/c1-2-3-8-13-11-12-9-6-4-5-7-10(9)14-11/h4-7H,2-3,8H2,1H3.
What are the key properties of 2-butylsulfanyl-1,3-benzothiazole?
2-butylsulfanyl-1,3-benzothiazole has a molecular weight of 223.37 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfanyl-1,3-benzothiazole is sourced from PubChem (CID 16838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).