C22H25ClN2O4S2 — CID 16838195
N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(4-propan-2-ylsulfonylphenyl)acetamide (PubChem CID 16838195) has the molecular formula C22H25ClN2O4S2 and a molecular weight of 481.04 g/mol. Its IUPAC name is N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(4-propan-2-ylsulfonylphenyl)acetamide.
| Compound Name | N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(4-propan-2-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 16838195 |
| Molecular Formula | C22H25ClN2O4S2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(4-propan-2-ylsulfonylphenyl)acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)Cc2ccc(S(=O)(=O)C(C)C)cc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H25ClN2O4S2/c1-4-29-12-11-25-19-10-7-17(23)14-20(19)30-22(25)24-21(26)13-16-5-8-18(9-6-16)31(27,28)15(2)3/h5-10,14-15H,4,11-13H2,1-3H3/b24-22- |
| InChIKey | PKXZCFANUQVBLB-GYHWCHFESA-N |
| XLogP | 4.24 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|