C15H20ClN3O4S2 — CID 43938197
N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-[methyl(methylsulfonyl)amino]acetamide (PubChem CID 43938197) has the molecular formula C15H20ClN3O4S2 and a molecular weight of 405.93 g/mol. Its IUPAC name is N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-[methyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-[methyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 43938197 |
| Molecular Formula | C15H20ClN3O4S2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-[methyl(methylsulfonyl)amino]acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)CN(C)S(C)(=O)=O)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H20ClN3O4S2/c1-4-23-8-7-19-12-6-5-11(16)9-13(12)24-15(19)17-14(20)10-18(2)25(3,21)22/h5-6,9H,4,7-8,10H2,1-3H3/b17-15- |
| InChIKey | GEKYPCRILDRHTH-ICFOKQHNSA-N |
| XLogP | 1.71 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|