C21H18FN7O — CID 16839232
1-(4-fluorophenyl)-3-[4-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]phenyl]urea (PubChem CID 16839232) has the molecular formula C21H18FN7O and a molecular weight of 403.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]phenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 16839232 |
| Molecular Formula | C21H18FN7O |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]phenyl]urea |
| SMILES | Cc1ccn(-c2ccc(Nc3ccc(NC(=O)Nc4ccc(F)cc4)cc3)nn2)n1 |
| InChI | InChI=1S/C21H18FN7O/c1-14-12-13-29(28-14)20-11-10-19(26-27-20)23-16-6-8-18(9-7-16)25-21(30)24-17-4-2-15(22)3-5-17/h2-13H,1H3,(H,23,26)(H2,24,25,30) |
| InChIKey | VGIPVEXZCOFTTM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |