C15H13FN4O — CID 16846376
1-(4-fluorophenyl)-4-methyl-6-prop-2-enylpyrazolo[4,5-d]pyridazin-7-one (PubChem CID 16846376) has the molecular formula C15H13FN4O and a molecular weight of 284.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-methyl-6-prop-2-enylpyrazolo[4,5-d]pyridazin-7-one.
| Compound Name | 1-(4-fluorophenyl)-4-methyl-6-prop-2-enylpyrazolo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 16846376 |
| Molecular Formula | C15H13FN4O |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-(4-fluorophenyl)-4-methyl-6-prop-2-enylpyrazolo[4,5-d]pyridazin-7-one |
| SMILES | C=CCn1nc(C)c2cnn(-c3ccc(F)cc3)c2c1=O |
| InChI | InChI=1S/C15H13FN4O/c1-3-8-19-15(21)14-13(10(2)18-19)9-17-20(14)12-6-4-11(16)5-7-12/h3-7,9H,1,8H2,2H3 |
| InChIKey | RPYAVDSQDXYIJN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|