C16H14N2O2 — CID 168501130
4-ethynyl-1-[3-(4-methylphenyl)-1,2-oxazol-5-yl]pyrrolidin-2-one (PubChem CID 168501130) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-ethynyl-1-[3-(4-methylphenyl)-1,2-oxazol-5-yl]pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-[3-(4-methylphenyl)-1,2-oxazol-5-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168501130 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-ethynyl-1-[3-(4-methylphenyl)-1,2-oxazol-5-yl]pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2cc(-c3ccc(C)cc3)no2)C1 |
| InChI | InChI=1S/C16H14N2O2/c1-3-12-8-15(19)18(10-12)16-9-14(17-20-16)13-6-4-11(2)5-7-13/h1,4-7,9,12H,8,10H2,2H3 |
| InChIKey | CKCYAGQDLGGKDS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|