About 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide
5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide (PubChem CID 168719208) has the molecular formula C13H13N3O4S
and a molecular weight of 307.33 g/mol. Its IUPAC name is 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide.
Molecular Properties
| Compound Name | 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide |
| PubChem CID | 168719208 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2cc(-c3ccccc3)no2)C1 |
| InChI | InChI=1S/C13H13N3O4S/c14-21(18,19)10-6-12(17)16(8-10)13-7-11(15-20-13)9-4-2-1-3-5-9/h1-5,7,10H,6,8H2,(H2,14,18,19) |
| InChIKey | DXIQGTXTTYWURF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide?
The IUPAC name of 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide (CID 168719208) is 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide.
What is the SMILES notation for 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide?
The canonical SMILES for 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide is NS(=O)(=O)C1CC(=O)N(c2cc(-c3ccccc3)no2)C1.
What is the InChIKey of 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide?
The InChIKey is DXIQGTXTTYWURF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4S/c14-21(18,19)10-6-12(17)16(8-10)13-7-11(15-20-13)9-4-2-1-3-5-9/h1-5,7,10H,6,8H2,(H2,14,18,19).
What are the key properties of 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide?
5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide has a molecular weight of 307.33 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1-(3-phenyl-1,2-oxazol-5-yl)pyrrolidine-3-sulfonamide is sourced from PubChem (CID 168719208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).