C11H17N3O4S — CID 168716862
1-(3-tert-butyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168716862) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168716862 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CC(C)(C)c1cc(N2CC(S(N)(=O)=O)CC2=O)on1 |
| InChI | InChI=1S/C11H17N3O4S/c1-11(2,3)8-5-10(18-13-8)14-6-7(4-9(14)15)19(12,16)17/h5,7H,4,6H2,1-3H3,(H2,12,16,17) |
| InChIKey | DOSLAPGTXRHWSN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |