C13H9ClN2OS — CID 168502569
1-(4-chloro-1,3-benzothiazol-2-yl)-4-ethynylpyrrolidin-2-one (PubChem CID 168502569) has the molecular formula C13H9ClN2OS and a molecular weight of 276.75 g/mol. Its IUPAC name is 1-(4-chloro-1,3-benzothiazol-2-yl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(4-chloro-1,3-benzothiazol-2-yl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168502569 |
| Molecular Formula | C13H9ClN2OS |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1-(4-chloro-1,3-benzothiazol-2-yl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2nc3c(Cl)cccc3s2)C1 |
| InChI | InChI=1S/C13H9ClN2OS/c1-2-8-6-11(17)16(7-8)13-15-12-9(14)4-3-5-10(12)18-13/h1,3-5,8H,6-7H2 |
| InChIKey | OXAQXSBMIMMRII-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|