C13H9N3O3S — CID 168503010
4-ethynyl-1-(6-nitro-1,3-benzothiazol-2-yl)pyrrolidin-2-one (PubChem CID 168503010) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 4-ethynyl-1-(6-nitro-1,3-benzothiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-(6-nitro-1,3-benzothiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168503010 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 4-ethynyl-1-(6-nitro-1,3-benzothiazol-2-yl)pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2nc3ccc([N+](=O)[O-])cc3s2)C1 |
| InChI | InChI=1S/C13H9N3O3S/c1-2-8-5-12(17)15(7-8)13-14-10-4-3-9(16(18)19)6-11(10)20-13/h1,3-4,6,8H,5,7H2 |
| InChIKey | PDAFIYTYUWOFBJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|