C10H9ClN4O — CID 168502718
1-(2-amino-6-chloropyrimidin-4-yl)-4-ethynylpyrrolidin-2-one (PubChem CID 168502718) has the molecular formula C10H9ClN4O and a molecular weight of 236.66 g/mol. Its IUPAC name is 1-(2-amino-6-chloropyrimidin-4-yl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(2-amino-6-chloropyrimidin-4-yl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168502718 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1-(2-amino-6-chloropyrimidin-4-yl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2cc(Cl)nc(N)n2)C1 |
| InChI | InChI=1S/C10H9ClN4O/c1-2-6-3-9(16)15(5-6)8-4-7(11)13-10(12)14-8/h1,4,6H,3,5H2,(H2,12,13,14) |
| InChIKey | FHKANSLCFYGMOE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|