C14H11N3O2 — CID 168502761
7-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-1,8-naphthyridin-2-one (PubChem CID 168502761) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 7-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 168502761 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 7-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-1,8-naphthyridin-2-one |
| SMILES | C#CC1CC(=O)N(c2ccc3ccc(=O)[nH]c3n2)C1 |
| InChI | InChI=1S/C14H11N3O2/c1-2-9-7-13(19)17(8-9)11-5-3-10-4-6-12(18)16-14(10)15-11/h1,3-6,9H,7-8H2,(H,15,16,18) |
| InChIKey | XUOSAYFEWPKXJS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|