C11H10N2O2 — CID 168502482
3-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-pyridin-4-one (PubChem CID 168502482) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-pyridin-4-one.
| Compound Name | 3-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 168502482 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-(4-ethynyl-2-oxopyrrolidin-1-yl)-1H-pyridin-4-one |
| SMILES | C#CC1CC(=O)N(c2c[nH]ccc2=O)C1 |
| InChI | InChI=1S/C11H10N2O2/c1-2-8-5-11(15)13(7-8)9-6-12-4-3-10(9)14/h1,3-4,6,8H,5,7H2,(H,12,14) |
| InChIKey | JUPQHBJVDVYZRJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|