C15H15N3O3S — CID 168668754
S-[[5-oxo-1-(7-oxo-8H-1,8-naphthyridin-2-yl)pyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668754) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is S-[[5-oxo-1-(7-oxo-8H-1,8-naphthyridin-2-yl)pyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[5-oxo-1-(7-oxo-8H-1,8-naphthyridin-2-yl)pyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668754 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | S-[[5-oxo-1-(7-oxo-8H-1,8-naphthyridin-2-yl)pyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2ccc3ccc(=O)[nH]c3n2)C1 |
| InChI | InChI=1S/C15H15N3O3S/c1-9(19)22-8-10-6-14(21)18(7-10)12-4-2-11-3-5-13(20)17-15(11)16-12/h2-5,10H,6-8H2,1H3,(H,16,17,20) |
| InChIKey | SUSSQTUDFCRZBE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|